C12H11N3O2 — CID 76844517
1-benzyl-2,4-dioxo-1,3-diazinane-5-carbonitrile (PubChem CID 76844517) has the molecular formula C12H11N3O2 and a molecular weight of 229.24 g/mol. Its IUPAC name is 1-benzyl-2,4-dioxo-1,3-diazinane-5-carbonitrile.
| Compound Name | 1-benzyl-2,4-dioxo-1,3-diazinane-5-carbonitrile |
|---|---|
| PubChem CID | 76844517 |
| Molecular Formula | C12H11N3O2 |
| Molecular Weight | 229.24 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | 1-benzyl-2,4-dioxo-1,3-diazinane-5-carbonitrile |
| SMILES | N#CC1CN(Cc2ccccc2)C(=O)NC1=O |
| InChI | InChI=1S/C12H11N3O2/c13-6-10-8-15(12(17)14-11(10)16)7-9-4-2-1-3-5-9/h1-5,10H,7-8H2,(H,14,16,17) |
| InChIKey | XYDIFYXFZAIDOG-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.24 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |