C14H15N3O5S — CID 78316756
2-(5-cyano-2,4-dioxo-1,3-diazinan-1-yl)ethyl 4-methylbenzenesulfonate (PubChem CID 78316756) has the molecular formula C14H15N3O5S and a molecular weight of 337.36 g/mol. Its IUPAC name is 2-(5-cyano-2,4-dioxo-1,3-diazinan-1-yl)ethyl 4-methylbenzenesulfonate.
| Compound Name | 2-(5-cyano-2,4-dioxo-1,3-diazinan-1-yl)ethyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 78316756 |
| Molecular Formula | C14H15N3O5S |
| Molecular Weight | 337.36 g/mol |
| Exact Mass | 337.07 |
| IUPAC Name | 2-(5-cyano-2,4-dioxo-1,3-diazinan-1-yl)ethyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCCN2CC(C#N)C(=O)NC2=O)cc1 |
| InChI | InChI=1S/C14H15N3O5S/c1-10-2-4-12(5-3-10)23(20,21)22-7-6-17-9-11(8-15)13(18)16-14(17)19/h2-5,11H,6-7,9H2,1H3,(H,16,18,19) |
| InChIKey | ZHOHMZOJFMJMOQ-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 116.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.36 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|