C12H14N4O2 — CID 7035831
(5R)-1-benzyl-2,4-dioxo-1,3-diazinane-5-carboximidamide (PubChem CID 7035831) has the molecular formula C12H14N4O2 and a molecular weight of 246.27 g/mol. Its IUPAC name is (5R)-1-benzyl-2,4-dioxo-1,3-diazinane-5-carboximidamide.
| Compound Name | (5R)-1-benzyl-2,4-dioxo-1,3-diazinane-5-carboximidamide |
|---|---|
| PubChem CID | 7035831 |
| Molecular Formula | C12H14N4O2 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.11 |
| IUPAC Name | (5R)-1-benzyl-2,4-dioxo-1,3-diazinane-5-carboximidamide |
| SMILES | [H]/N=C(\N)[C@H]1CN(Cc2ccccc2)C(=O)NC1=O |
| InChI | InChI=1S/C12H14N4O2/c13-10(14)9-7-16(12(18)15-11(9)17)6-8-4-2-1-3-5-8/h1-5,9H,6-7H2,(H3,13,14)(H,15,17,18)/t9-/m1/s1 |
| InChIKey | IUDFLJQKOKLSCD-SECBINFHSA-N |
| XLogP | 0.29 |
| TPSA | 99.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|