3-(5-carbamoyl-2,4-dioxo-1,3-diazinan-1-yl)propanoic acid

C8H11N3O5 — CID 138058739

IUPAC3-(5-carbamoyl-2,4-dioxo-1,3-diazinan-1-yl)propanoic acid
SMILESNC(=O)C1CN(CCC(=O)O)C(=O)NC1=O
InChIInChI=1S/C8H11N3O5/c9-6(14)4-3-11(2-1-5(12)13)8(16)10-7(4)15/h4H,1-3H2,(H2,9,14)(H,12,13)(H,10,15,16)
InChIKeyPNXKLJFKGHWEGN-UHFFFAOYSA-N
MW229.19 g/mol
LogP-1.89
Rot. Bonds4

About 3-(5-carbamoyl-2,4-dioxo-1,3-diazinan-1-yl)propanoic acid

3-(5-carbamoyl-2,4-dioxo-1,3-diazinan-1-yl)propanoic acid (PubChem CID 138058739) has the molecular formula C8H11N3O5 and a molecular weight of 229.19 g/mol. Its IUPAC name is 3-(5-carbamoyl-2,4-dioxo-1,3-diazinan-1-yl)propanoic acid.

Molecular Properties

Compound Name3-(5-carbamoyl-2,4-dioxo-1,3-diazinan-1-yl)propanoic acid
PubChem CID138058739
Molecular FormulaC8H11N3O5
Molecular Weight229.19 g/mol
Exact Mass229.07
IUPAC Name3-(5-carbamoyl-2,4-dioxo-1,3-diazinan-1-yl)propanoic acid
SMILESNC(=O)C1CN(CCC(=O)O)C(=O)NC1=O
InChIInChI=1S/C8H11N3O5/c9-6(14)4-3-11(2-1-5(12)13)8(16)10-7(4)15/h4H,1-3H2,(H2,9,14)(H,12,13)(H,10,15,16)
InChIKeyPNXKLJFKGHWEGN-UHFFFAOYSA-N
XLogP-1.89
TPSA129.80 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500229.19
LogP ≤ 5-1.89
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}

Analyze 3-(5-carbamoyl-2,4-dioxo-1,3-diazinan-1-yl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(5-carbamoyl-2,4-dioxo-1,3-diazinan-1-yl)propanoic acid?
The IUPAC name of 3-(5-carbamoyl-2,4-dioxo-1,3-diazinan-1-yl)propanoic acid (CID 138058739) is 3-(5-carbamoyl-2,4-dioxo-1,3-diazinan-1-yl)propanoic acid.
What is the SMILES notation for 3-(5-carbamoyl-2,4-dioxo-1,3-diazinan-1-yl)propanoic acid?
The canonical SMILES for 3-(5-carbamoyl-2,4-dioxo-1,3-diazinan-1-yl)propanoic acid is NC(=O)C1CN(CCC(=O)O)C(=O)NC1=O.
What is the InChIKey of 3-(5-carbamoyl-2,4-dioxo-1,3-diazinan-1-yl)propanoic acid?
The InChIKey is PNXKLJFKGHWEGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3O5/c9-6(14)4-3-11(2-1-5(12)13)8(16)10-7(4)15/h4H,1-3H2,(H2,9,14)(H,12,13)(H,10,15,16).
What are the key properties of 3-(5-carbamoyl-2,4-dioxo-1,3-diazinan-1-yl)propanoic acid?
3-(5-carbamoyl-2,4-dioxo-1,3-diazinan-1-yl)propanoic acid has a molecular weight of 229.19 g/mol, XLogP of -1.89, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5-carbamoyl-2,4-dioxo-1,3-diazinan-1-yl)propanoic acid is sourced from PubChem (CID 138058739), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).