C8H11N3O5 — CID 138058739
3-(5-carbamoyl-2,4-dioxo-1,3-diazinan-1-yl)propanoic acid (PubChem CID 138058739) has the molecular formula C8H11N3O5 and a molecular weight of 229.19 g/mol. Its IUPAC name is 3-(5-carbamoyl-2,4-dioxo-1,3-diazinan-1-yl)propanoic acid.
| Compound Name | 3-(5-carbamoyl-2,4-dioxo-1,3-diazinan-1-yl)propanoic acid |
|---|---|
| PubChem CID | 138058739 |
| Molecular Formula | C8H11N3O5 |
| Molecular Weight | 229.19 g/mol |
| Exact Mass | 229.07 |
| IUPAC Name | 3-(5-carbamoyl-2,4-dioxo-1,3-diazinan-1-yl)propanoic acid |
| SMILES | NC(=O)C1CN(CCC(=O)O)C(=O)NC1=O |
| InChI | InChI=1S/C8H11N3O5/c9-6(14)4-3-11(2-1-5(12)13)8(16)10-7(4)15/h4H,1-3H2,(H2,9,14)(H,12,13)(H,10,15,16) |
| InChIKey | PNXKLJFKGHWEGN-UHFFFAOYSA-N |
| XLogP | -1.89 |
| TPSA | 129.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.19 |
| LogP ≤ 5 | -1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|