C9H13FN2O4 — CID 44508421
ethyl 3-(5-fluoro-2,4-dioxo-1,3-diazinan-1-yl)propanoate (PubChem CID 44508421) has the molecular formula C9H13FN2O4 and a molecular weight of 232.21 g/mol. Its IUPAC name is ethyl 3-(5-fluoro-2,4-dioxo-1,3-diazinan-1-yl)propanoate.
| Compound Name | ethyl 3-(5-fluoro-2,4-dioxo-1,3-diazinan-1-yl)propanoate |
|---|---|
| PubChem CID | 44508421 |
| Molecular Formula | C9H13FN2O4 |
| Molecular Weight | 232.21 g/mol |
| Exact Mass | 232.09 |
| IUPAC Name | ethyl 3-(5-fluoro-2,4-dioxo-1,3-diazinan-1-yl)propanoate |
| SMILES | CCOC(=O)CCN1CC(F)C(=O)NC1=O |
| InChI | InChI=1S/C9H13FN2O4/c1-2-16-7(13)3-4-12-5-6(10)8(14)11-9(12)15/h6H,2-5H2,1H3,(H,11,14,15) |
| InChIKey | OORGLMSUEGPXCJ-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.21 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |