C12H16N4O2 — CID 150818622
ethyl 3-[2-(dicyanomethylidene)-1,3-diazinan-1-yl]propanoate (PubChem CID 150818622) has the molecular formula C12H16N4O2 and a molecular weight of 248.29 g/mol. Its IUPAC name is ethyl 3-[2-(dicyanomethylidene)-1,3-diazinan-1-yl]propanoate.
| Compound Name | ethyl 3-[2-(dicyanomethylidene)-1,3-diazinan-1-yl]propanoate |
|---|---|
| PubChem CID | 150818622 |
| Molecular Formula | C12H16N4O2 |
| Molecular Weight | 248.29 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | ethyl 3-[2-(dicyanomethylidene)-1,3-diazinan-1-yl]propanoate |
| SMILES | CCOC(=O)CCN1CCCNC1=C(C#N)C#N |
| InChI | InChI=1S/C12H16N4O2/c1-2-18-11(17)4-7-16-6-3-5-15-12(16)10(8-13)9-14/h15H,2-7H2,1H3 |
| InChIKey | KJLCSFDISAYOOV-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 89.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.29 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|