C20H30N4O8 — CID 11712165
ethyl 3-[1-[4-[4-(3-ethoxy-3-oxopropyl)-2,5-dioxoimidazolidin-1-yl]butyl]-2,5-dioxoimidazolidin-4-yl]propanoate (PubChem CID 11712165) has the molecular formula C20H30N4O8 and a molecular weight of 454.48 g/mol. Its IUPAC name is ethyl 3-[1-[4-[4-(3-ethoxy-3-oxopropyl)-2,5-dioxoimidazolidin-1-yl]butyl]-2,5-dioxoimidazolidin-4-yl]propanoate.
| Compound Name | ethyl 3-[1-[4-[4-(3-ethoxy-3-oxopropyl)-2,5-dioxoimidazolidin-1-yl]butyl]-2,5-dioxoimidazolidin-4-yl]propanoate |
|---|---|
| PubChem CID | 11712165 |
| Molecular Formula | C20H30N4O8 |
| Molecular Weight | 454.48 g/mol |
| Exact Mass | 454.21 |
| IUPAC Name | ethyl 3-[1-[4-[4-(3-ethoxy-3-oxopropyl)-2,5-dioxoimidazolidin-1-yl]butyl]-2,5-dioxoimidazolidin-4-yl]propanoate |
| SMILES | CCOC(=O)CCC1NC(=O)N(CCCCN2C(=O)NC(CCC(=O)OCC)C2=O)C1=O |
| InChI | InChI=1S/C20H30N4O8/c1-3-31-15(25)9-7-13-17(27)23(19(29)21-13)11-5-6-12-24-18(28)14(22-20(24)30)8-10-16(26)32-4-2/h13-14H,3-12H2,1-2H3,(H,21,29)(H,22,30) |
| InChIKey | LFUJIPIFKSALLT-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 151.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.48 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|