C12H20N2O4 — CID 54942288
butyl 2-(2,5-dioxo-4-propylimidazolidin-1-yl)acetate (PubChem CID 54942288) has the molecular formula C12H20N2O4 and a molecular weight of 256.30 g/mol. Its IUPAC name is butyl 2-(2,5-dioxo-4-propylimidazolidin-1-yl)acetate.
| Compound Name | butyl 2-(2,5-dioxo-4-propylimidazolidin-1-yl)acetate |
|---|---|
| PubChem CID | 54942288 |
| Molecular Formula | C12H20N2O4 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | butyl 2-(2,5-dioxo-4-propylimidazolidin-1-yl)acetate |
| SMILES | CCCCOC(=O)CN1C(=O)NC(CCC)C1=O |
| InChI | InChI=1S/C12H20N2O4/c1-3-5-7-18-10(15)8-14-11(16)9(6-4-2)13-12(14)17/h9H,3-8H2,1-2H3,(H,13,17) |
| InChIKey | ZCNMZYPFDQRUJB-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|