C19H25N3O5S — CID 55305807
butyl 4-[[2-[4-(2-methylsulfanylethyl)-2,5-dioxoimidazolidin-1-yl]acetyl]amino]benzoate (PubChem CID 55305807) has the molecular formula C19H25N3O5S and a molecular weight of 407.49 g/mol. Its IUPAC name is butyl 4-[[2-[4-(2-methylsulfanylethyl)-2,5-dioxoimidazolidin-1-yl]acetyl]amino]benzoate.
| Compound Name | butyl 4-[[2-[4-(2-methylsulfanylethyl)-2,5-dioxoimidazolidin-1-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 55305807 |
| Molecular Formula | C19H25N3O5S |
| Molecular Weight | 407.49 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | butyl 4-[[2-[4-(2-methylsulfanylethyl)-2,5-dioxoimidazolidin-1-yl]acetyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1ccc(NC(=O)CN2C(=O)NC(CCSC)C2=O)cc1 |
| InChI | InChI=1S/C19H25N3O5S/c1-3-4-10-27-18(25)13-5-7-14(8-6-13)20-16(23)12-22-17(24)15(9-11-28-2)21-19(22)26/h5-8,15H,3-4,9-12H2,1-2H3,(H,20,23)(H,21,26) |
| InChIKey | YDTJJNCFHHECPS-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.49 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|