C16H15N3O5 — CID 124881965
methyl 4-[[2-[(4R)-2,5-dioxo-4-prop-2-ynylimidazolidin-1-yl]acetyl]amino]benzoate (PubChem CID 124881965) has the molecular formula C16H15N3O5 and a molecular weight of 329.31 g/mol. Its IUPAC name is methyl 4-[[2-[(4R)-2,5-dioxo-4-prop-2-ynylimidazolidin-1-yl]acetyl]amino]benzoate.
| Compound Name | methyl 4-[[2-[(4R)-2,5-dioxo-4-prop-2-ynylimidazolidin-1-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 124881965 |
| Molecular Formula | C16H15N3O5 |
| Molecular Weight | 329.31 g/mol |
| Exact Mass | 329.10 |
| IUPAC Name | methyl 4-[[2-[(4R)-2,5-dioxo-4-prop-2-ynylimidazolidin-1-yl]acetyl]amino]benzoate |
| SMILES | C#CC[C@H]1NC(=O)N(CC(=O)Nc2ccc(C(=O)OC)cc2)C1=O |
| InChI | InChI=1S/C16H15N3O5/c1-3-4-12-14(21)19(16(23)18-12)9-13(20)17-11-7-5-10(6-8-11)15(22)24-2/h1,5-8,12H,4,9H2,2H3,(H,17,20)(H,18,23)/t12-/m1/s1 |
| InChIKey | RYHBRKALJUAMHP-GFCCVEGCSA-N |
| XLogP | 0.36 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.31 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|