C9H12N2O6 — CID 134107553
2-[(4S)-1-(2-ethoxy-2-oxoethyl)-2,5-dioxoimidazolidin-4-yl]acetic acid (PubChem CID 134107553) has the molecular formula C9H12N2O6 and a molecular weight of 244.20 g/mol. Its IUPAC name is 2-[(4S)-1-(2-ethoxy-2-oxoethyl)-2,5-dioxoimidazolidin-4-yl]acetic acid.
| Compound Name | 2-[(4S)-1-(2-ethoxy-2-oxoethyl)-2,5-dioxoimidazolidin-4-yl]acetic acid |
|---|---|
| PubChem CID | 134107553 |
| Molecular Formula | C9H12N2O6 |
| Molecular Weight | 244.20 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | 2-[(4S)-1-(2-ethoxy-2-oxoethyl)-2,5-dioxoimidazolidin-4-yl]acetic acid |
| SMILES | CCOC(=O)CN1C(=O)N[C@@H](CC(=O)O)C1=O |
| InChI | InChI=1S/C9H12N2O6/c1-2-17-7(14)4-11-8(15)5(3-6(12)13)10-9(11)16/h5H,2-4H2,1H3,(H,10,16)(H,12,13)/t5-/m0/s1 |
| InChIKey | VFXCODCVFSNALI-YFKPBYRVSA-N |
| XLogP | -1.06 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.20 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|