C7H10N2O3S — CID 124676635
2-[(4R)-1-ethyl-5-oxo-2-sulfanylideneimidazolidin-4-yl]acetic acid (PubChem CID 124676635) has the molecular formula C7H10N2O3S and a molecular weight of 202.23 g/mol. Its IUPAC name is 2-[(4R)-1-ethyl-5-oxo-2-sulfanylideneimidazolidin-4-yl]acetic acid.
| Compound Name | 2-[(4R)-1-ethyl-5-oxo-2-sulfanylideneimidazolidin-4-yl]acetic acid |
|---|---|
| PubChem CID | 124676635 |
| Molecular Formula | C7H10N2O3S |
| Molecular Weight | 202.23 g/mol |
| Exact Mass | 202.04 |
| IUPAC Name | 2-[(4R)-1-ethyl-5-oxo-2-sulfanylideneimidazolidin-4-yl]acetic acid |
| SMILES | CCN1C(=O)[C@@H](CC(=O)O)NC1=S |
| InChI | InChI=1S/C7H10N2O3S/c1-2-9-6(12)4(3-5(10)11)8-7(9)13/h4H,2-3H2,1H3,(H,8,13)(H,10,11)/t4-/m1/s1 |
| InChIKey | ZZSWTUNRXFGVIO-SCSAIBSYSA-N |
| XLogP | -0.43 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.23 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|