C8H12N2O3S — CID 124676638
2-[(4S)-5-oxo-1-propan-2-yl-2-sulfanylideneimidazolidin-4-yl]acetic acid (PubChem CID 124676638) has the molecular formula C8H12N2O3S and a molecular weight of 216.26 g/mol. Its IUPAC name is 2-[(4S)-5-oxo-1-propan-2-yl-2-sulfanylideneimidazolidin-4-yl]acetic acid.
| Compound Name | 2-[(4S)-5-oxo-1-propan-2-yl-2-sulfanylideneimidazolidin-4-yl]acetic acid |
|---|---|
| PubChem CID | 124676638 |
| Molecular Formula | C8H12N2O3S |
| Molecular Weight | 216.26 g/mol |
| Exact Mass | 216.06 |
| IUPAC Name | 2-[(4S)-5-oxo-1-propan-2-yl-2-sulfanylideneimidazolidin-4-yl]acetic acid |
| SMILES | CC(C)N1C(=O)[C@H](CC(=O)O)NC1=S |
| InChI | InChI=1S/C8H12N2O3S/c1-4(2)10-7(13)5(3-6(11)12)9-8(10)14/h4-5H,3H2,1-2H3,(H,9,14)(H,11,12)/t5-/m0/s1 |
| InChIKey | LUVXOJYZBSHPGY-YFKPBYRVSA-N |
| XLogP | -0.05 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.26 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|