2-(3-oxo-4-propan-2-yl-1,4-benzoxazin-2-yl)acetic acid

C13H15NO4 — CID 82025745

IUPAC2-(3-oxo-4-propan-2-yl-1,4-benzoxazin-2-yl)acetic acid
SMILESCC(C)N1C(=O)C(CC(=O)O)Oc2ccccc21
InChIInChI=1S/C13H15NO4/c1-8(2)14-9-5-3-4-6-10(9)18-11(13(14)17)7-12(15)16/h3-6,8,11H,7H2,1-2H3,(H,15,16)
InChIKeyVMAMVZCOXYVFJO-UHFFFAOYSA-N
MW249.27 g/mol
LogP1.66
Rot. Bonds3

About 2-(3-oxo-4-propan-2-yl-1,4-benzoxazin-2-yl)acetic acid

2-(3-oxo-4-propan-2-yl-1,4-benzoxazin-2-yl)acetic acid (PubChem CID 82025745) has the molecular formula C13H15NO4 and a molecular weight of 249.27 g/mol. Its IUPAC name is 2-(3-oxo-4-propan-2-yl-1,4-benzoxazin-2-yl)acetic acid.

Molecular Properties

Compound Name2-(3-oxo-4-propan-2-yl-1,4-benzoxazin-2-yl)acetic acid
PubChem CID82025745
Molecular FormulaC13H15NO4
Molecular Weight249.27 g/mol
Exact Mass249.10
IUPAC Name2-(3-oxo-4-propan-2-yl-1,4-benzoxazin-2-yl)acetic acid
SMILESCC(C)N1C(=O)C(CC(=O)O)Oc2ccccc21
InChIInChI=1S/C13H15NO4/c1-8(2)14-9-5-3-4-6-10(9)18-11(13(14)17)7-12(15)16/h3-6,8,11H,7H2,1-2H3,(H,15,16)
InChIKeyVMAMVZCOXYVFJO-UHFFFAOYSA-N
XLogP1.66
TPSA66.84 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500249.27
LogP ≤ 51.66
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-(3-oxo-4-propan-2-yl-1,4-benzoxazin-2-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(3-oxo-4-propan-2-yl-1,4-benzoxazin-2-yl)acetic acid?
The IUPAC name of 2-(3-oxo-4-propan-2-yl-1,4-benzoxazin-2-yl)acetic acid (CID 82025745) is 2-(3-oxo-4-propan-2-yl-1,4-benzoxazin-2-yl)acetic acid.
What is the SMILES notation for 2-(3-oxo-4-propan-2-yl-1,4-benzoxazin-2-yl)acetic acid?
The canonical SMILES for 2-(3-oxo-4-propan-2-yl-1,4-benzoxazin-2-yl)acetic acid is CC(C)N1C(=O)C(CC(=O)O)Oc2ccccc21.
What is the InChIKey of 2-(3-oxo-4-propan-2-yl-1,4-benzoxazin-2-yl)acetic acid?
The InChIKey is VMAMVZCOXYVFJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15NO4/c1-8(2)14-9-5-3-4-6-10(9)18-11(13(14)17)7-12(15)16/h3-6,8,11H,7H2,1-2H3,(H,15,16).
What are the key properties of 2-(3-oxo-4-propan-2-yl-1,4-benzoxazin-2-yl)acetic acid?
2-(3-oxo-4-propan-2-yl-1,4-benzoxazin-2-yl)acetic acid has a molecular weight of 249.27 g/mol, XLogP of 1.66, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-oxo-4-propan-2-yl-1,4-benzoxazin-2-yl)acetic acid is sourced from PubChem (CID 82025745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).