C15H19NO4 — CID 82025550
2-(2-ethyl-3-oxo-4-propan-2-yl-1,4-benzoxazin-6-yl)acetic acid (PubChem CID 82025550) has the molecular formula C15H19NO4 and a molecular weight of 277.32 g/mol. Its IUPAC name is 2-(2-ethyl-3-oxo-4-propan-2-yl-1,4-benzoxazin-6-yl)acetic acid.
| Compound Name | 2-(2-ethyl-3-oxo-4-propan-2-yl-1,4-benzoxazin-6-yl)acetic acid |
|---|---|
| PubChem CID | 82025550 |
| Molecular Formula | C15H19NO4 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | 2-(2-ethyl-3-oxo-4-propan-2-yl-1,4-benzoxazin-6-yl)acetic acid |
| SMILES | CCC1Oc2ccc(CC(=O)O)cc2N(C(C)C)C1=O |
| InChI | InChI=1S/C15H19NO4/c1-4-12-15(19)16(9(2)3)11-7-10(8-14(17)18)5-6-13(11)20-12/h5-7,9,12H,4,8H2,1-3H3,(H,17,18) |
| InChIKey | NMRFWTXLBDATIJ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |