2-(2-ethyl-3-oxo-4-propan-2-yl-1,4-benzoxazin-6-yl)acetic acid

C15H19NO4 — CID 82025550

IUPAC2-(2-ethyl-3-oxo-4-propan-2-yl-1,4-benzoxazin-6-yl)acetic acid
SMILESCCC1Oc2ccc(CC(=O)O)cc2N(C(C)C)C1=O
InChIInChI=1S/C15H19NO4/c1-4-12-15(19)16(9(2)3)11-7-10(8-14(17)18)5-6-13(11)20-12/h5-7,9,12H,4,8H2,1-3H3,(H,17,18)
InChIKeyNMRFWTXLBDATIJ-UHFFFAOYSA-N
MW277.32 g/mol
LogP2.23
Rot. Bonds4

About 2-(2-ethyl-3-oxo-4-propan-2-yl-1,4-benzoxazin-6-yl)acetic acid

2-(2-ethyl-3-oxo-4-propan-2-yl-1,4-benzoxazin-6-yl)acetic acid (PubChem CID 82025550) has the molecular formula C15H19NO4 and a molecular weight of 277.32 g/mol. Its IUPAC name is 2-(2-ethyl-3-oxo-4-propan-2-yl-1,4-benzoxazin-6-yl)acetic acid.

Molecular Properties

Compound Name2-(2-ethyl-3-oxo-4-propan-2-yl-1,4-benzoxazin-6-yl)acetic acid
PubChem CID82025550
Molecular FormulaC15H19NO4
Molecular Weight277.32 g/mol
Exact Mass277.13
IUPAC Name2-(2-ethyl-3-oxo-4-propan-2-yl-1,4-benzoxazin-6-yl)acetic acid
SMILESCCC1Oc2ccc(CC(=O)O)cc2N(C(C)C)C1=O
InChIInChI=1S/C15H19NO4/c1-4-12-15(19)16(9(2)3)11-7-10(8-14(17)18)5-6-13(11)20-12/h5-7,9,12H,4,8H2,1-3H3,(H,17,18)
InChIKeyNMRFWTXLBDATIJ-UHFFFAOYSA-N
XLogP2.23
TPSA66.84 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500277.32
LogP ≤ 52.23
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-(2-ethyl-3-oxo-4-propan-2-yl-1,4-benzoxazin-6-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2-ethyl-3-oxo-4-propan-2-yl-1,4-benzoxazin-6-yl)acetic acid?
The IUPAC name of 2-(2-ethyl-3-oxo-4-propan-2-yl-1,4-benzoxazin-6-yl)acetic acid (CID 82025550) is 2-(2-ethyl-3-oxo-4-propan-2-yl-1,4-benzoxazin-6-yl)acetic acid.
What is the SMILES notation for 2-(2-ethyl-3-oxo-4-propan-2-yl-1,4-benzoxazin-6-yl)acetic acid?
The canonical SMILES for 2-(2-ethyl-3-oxo-4-propan-2-yl-1,4-benzoxazin-6-yl)acetic acid is CCC1Oc2ccc(CC(=O)O)cc2N(C(C)C)C1=O.
What is the InChIKey of 2-(2-ethyl-3-oxo-4-propan-2-yl-1,4-benzoxazin-6-yl)acetic acid?
The InChIKey is NMRFWTXLBDATIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19NO4/c1-4-12-15(19)16(9(2)3)11-7-10(8-14(17)18)5-6-13(11)20-12/h5-7,9,12H,4,8H2,1-3H3,(H,17,18).
What are the key properties of 2-(2-ethyl-3-oxo-4-propan-2-yl-1,4-benzoxazin-6-yl)acetic acid?
2-(2-ethyl-3-oxo-4-propan-2-yl-1,4-benzoxazin-6-yl)acetic acid has a molecular weight of 277.32 g/mol, XLogP of 2.23, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-ethyl-3-oxo-4-propan-2-yl-1,4-benzoxazin-6-yl)acetic acid is sourced from PubChem (CID 82025550), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).