C18H28N2O2 — CID 82339815
6-(4-aminobutyl)-2,4-di(propan-2-yl)-1,4-benzoxazin-3-one (PubChem CID 82339815) has the molecular formula C18H28N2O2 and a molecular weight of 304.43 g/mol. Its IUPAC name is 6-(4-aminobutyl)-2,4-di(propan-2-yl)-1,4-benzoxazin-3-one.
| Compound Name | 6-(4-aminobutyl)-2,4-di(propan-2-yl)-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 82339815 |
| Molecular Formula | C18H28N2O2 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.22 |
| IUPAC Name | 6-(4-aminobutyl)-2,4-di(propan-2-yl)-1,4-benzoxazin-3-one |
| SMILES | CC(C)C1Oc2ccc(CCCCN)cc2N(C(C)C)C1=O |
| InChI | InChI=1S/C18H28N2O2/c1-12(2)17-18(21)20(13(3)4)15-11-14(7-5-6-10-19)8-9-16(15)22-17/h8-9,11-13,17H,5-7,10,19H2,1-4H3 |
| InChIKey | MFNWDHBVSYPHFF-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|