C6H9N3O4 — CID 59953083
2-[(4S)-4-(aminomethyl)-2,5-dioxoimidazolidin-1-yl]acetic acid (PubChem CID 59953083) has the molecular formula C6H9N3O4 and a molecular weight of 187.15 g/mol. Its IUPAC name is 2-[(4S)-4-(aminomethyl)-2,5-dioxoimidazolidin-1-yl]acetic acid.
| Compound Name | 2-[(4S)-4-(aminomethyl)-2,5-dioxoimidazolidin-1-yl]acetic acid |
|---|---|
| PubChem CID | 59953083 |
| Molecular Formula | C6H9N3O4 |
| Molecular Weight | 187.15 g/mol |
| Exact Mass | 187.06 |
| IUPAC Name | 2-[(4S)-4-(aminomethyl)-2,5-dioxoimidazolidin-1-yl]acetic acid |
| SMILES | NC[C@@H]1NC(=O)N(CC(=O)O)C1=O |
| InChI | InChI=1S/C6H9N3O4/c7-1-3-5(12)9(2-4(10)11)6(13)8-3/h3H,1-2,7H2,(H,8,13)(H,10,11)/t3-/m0/s1 |
| InChIKey | FFNUKJPGKYBYFH-VKHMYHEASA-N |
| XLogP | -2.05 |
| TPSA | 112.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.15 |
| LogP ≤ 5 | -2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|