C9H15N5O4 — CID 67796016
2-[4-[(1R)-1-(diaminomethylideneamino)propyl]-2,5-dioxoimidazolidin-1-yl]acetic acid (PubChem CID 67796016) has the molecular formula C9H15N5O4 and a molecular weight of 257.25 g/mol. Its IUPAC name is 2-[4-[(1R)-1-(diaminomethylideneamino)propyl]-2,5-dioxoimidazolidin-1-yl]acetic acid.
| Compound Name | 2-[4-[(1R)-1-(diaminomethylideneamino)propyl]-2,5-dioxoimidazolidin-1-yl]acetic acid |
|---|---|
| PubChem CID | 67796016 |
| Molecular Formula | C9H15N5O4 |
| Molecular Weight | 257.25 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | 2-[4-[(1R)-1-(diaminomethylideneamino)propyl]-2,5-dioxoimidazolidin-1-yl]acetic acid |
| SMILES | CC[C@@H](N=C(N)N)C1NC(=O)N(CC(=O)O)C1=O |
| InChI | InChI=1S/C9H15N5O4/c1-2-4(12-8(10)11)6-7(17)14(3-5(15)16)9(18)13-6/h4,6H,2-3H2,1H3,(H,13,18)(H,15,16)(H4,10,11,12)/t4-,6?/m1/s1 |
| InChIKey | FCHCFBUGQCSBES-NJXYFUOMSA-N |
| XLogP | -1.96 |
| TPSA | 151.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.25 |
| LogP ≤ 5 | -1.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|