C15H20N4O4S — CID 70091475
2-[1-[(2R,3S)-1-acetyl-2-(benzenesulfonyl)-4-oxoazetidin-3-yl]propyl]guanidine (PubChem CID 70091475) has the molecular formula C15H20N4O4S and a molecular weight of 352.42 g/mol. Its IUPAC name is 2-[1-[(2R,3S)-1-acetyl-2-(benzenesulfonyl)-4-oxoazetidin-3-yl]propyl]guanidine.
| Compound Name | 2-[1-[(2R,3S)-1-acetyl-2-(benzenesulfonyl)-4-oxoazetidin-3-yl]propyl]guanidine |
|---|---|
| PubChem CID | 70091475 |
| Molecular Formula | C15H20N4O4S |
| Molecular Weight | 352.42 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | 2-[1-[(2R,3S)-1-acetyl-2-(benzenesulfonyl)-4-oxoazetidin-3-yl]propyl]guanidine |
| SMILES | CCC(N=C(N)N)[C@H]1C(=O)N(C(C)=O)[C@@H]1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C15H20N4O4S/c1-3-11(18-15(16)17)12-13(21)19(9(2)20)14(12)24(22,23)10-7-5-4-6-8-10/h4-8,11-12,14H,3H2,1-2H3,(H4,16,17,18)/t11?,12-,14+/m0/s1 |
| InChIKey | PUYKWWGRDWOXIK-VBVNFKHJSA-N |
| XLogP | -0.16 |
| TPSA | 135.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.42 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|