C17H24N2O5S — CID 154988425
(2S)-2-[(3S)-4-(benzenesulfonyl)-2-hydroxy-5-oxo-3-propylpyrrolidin-1-yl]butanamide (PubChem CID 154988425) has the molecular formula C17H24N2O5S and a molecular weight of 368.46 g/mol. Its IUPAC name is (2S)-2-[(3S)-4-(benzenesulfonyl)-2-hydroxy-5-oxo-3-propylpyrrolidin-1-yl]butanamide.
| Compound Name | (2S)-2-[(3S)-4-(benzenesulfonyl)-2-hydroxy-5-oxo-3-propylpyrrolidin-1-yl]butanamide |
|---|---|
| PubChem CID | 154988425 |
| Molecular Formula | C17H24N2O5S |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | (2S)-2-[(3S)-4-(benzenesulfonyl)-2-hydroxy-5-oxo-3-propylpyrrolidin-1-yl]butanamide |
| SMILES | CCC[C@H]1C(O)N([C@@H](CC)C(N)=O)C(=O)C1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C17H24N2O5S/c1-3-8-12-14(25(23,24)11-9-6-5-7-10-11)17(22)19(16(12)21)13(4-2)15(18)20/h5-7,9-10,12-14,16,21H,3-4,8H2,1-2H3,(H2,18,20)/t12-,13+,14?,16?/m1/s1 |
| InChIKey | ODWGIOXRNSRQSR-NNNQGMHWSA-N |
| XLogP | 0.67 |
| TPSA | 117.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |