C15H22O3S — CID 139093015
(1R)-1-[(1S,2S,3R)-2-(benzenesulfonyl)-3-butylcyclopropyl]ethanol (PubChem CID 139093015) has the molecular formula C15H22O3S and a molecular weight of 282.40 g/mol. Its IUPAC name is (1R)-1-[(1S,2S,3R)-2-(benzenesulfonyl)-3-butylcyclopropyl]ethanol.
| Compound Name | (1R)-1-[(1S,2S,3R)-2-(benzenesulfonyl)-3-butylcyclopropyl]ethanol |
|---|---|
| PubChem CID | 139093015 |
| Molecular Formula | C15H22O3S |
| Molecular Weight | 282.40 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | (1R)-1-[(1S,2S,3R)-2-(benzenesulfonyl)-3-butylcyclopropyl]ethanol |
| SMILES | CCCC[C@@H]1[C@@H]([C@@H](C)O)[C@H]1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C15H22O3S/c1-3-4-10-13-14(11(2)16)15(13)19(17,18)12-8-6-5-7-9-12/h5-9,11,13-16H,3-4,10H2,1-2H3/t11-,13-,14-,15+/m1/s1 |
| InChIKey | SRDHZEADBUNFMW-NGFQHRJXSA-N |
| XLogP | 2.65 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.40 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |