C19H33N7O6 — CID 59873395
(3S)-3-[[2-[(4S)-4-[3-(diaminomethylideneamino)propyl]-2,5-dioxoimidazolidin-1-yl]acetyl]amino]-4-(4-methylpentan-2-ylamino)-4-oxobutanoic acid (PubChem CID 59873395) has the molecular formula C19H33N7O6 and a molecular weight of 455.52 g/mol. Its IUPAC name is (3S)-3-[[2-[(4S)-4-[3-(diaminomethylideneamino)propyl]-2,5-dioxoimidazolidin-1-yl]acetyl]amino]-4-(4-methylpentan-2-ylamino)-4-oxobutanoic acid.
| Compound Name | (3S)-3-[[2-[(4S)-4-[3-(diaminomethylideneamino)propyl]-2,5-dioxoimidazolidin-1-yl]acetyl]amino]-4-(4-methylpentan-2-ylamino)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 59873395 |
| Molecular Formula | C19H33N7O6 |
| Molecular Weight | 455.52 g/mol |
| Exact Mass | 455.25 |
| IUPAC Name | (3S)-3-[[2-[(4S)-4-[3-(diaminomethylideneamino)propyl]-2,5-dioxoimidazolidin-1-yl]acetyl]amino]-4-(4-methylpentan-2-ylamino)-4-oxobutanoic acid |
| SMILES | CC(C)CC(C)NC(=O)[C@H](CC(=O)O)NC(=O)CN1C(=O)N[C@@H](CCCN=C(N)N)C1=O |
| InChI | InChI=1S/C19H33N7O6/c1-10(2)7-11(3)23-16(30)13(8-15(28)29)24-14(27)9-26-17(31)12(25-19(26)32)5-4-6-22-18(20)21/h10-13H,4-9H2,1-3H3,(H,23,30)(H,24,27)(H,25,32)(H,28,29)(H4,20,21,22)/t11?,12-,13-/m0/s1 |
| InChIKey | BGWAWWYSSHKLRO-SPOOISQMSA-N |
| XLogP | -1.53 |
| TPSA | 209.31 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.52 |
| LogP ≤ 5 | -1.53 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|