C30H37N7O8 — CID 22945295
4-[[carboxy(phenyl)methyl]amino]-3-[[2-[4-[3-(diaminomethylideneamino)propyl]-2,5-dioxo-3-(3-phenylpropyl)imidazolidin-1-yl]acetyl]amino]-4-oxobutanoic acid (PubChem CID 22945295) has the molecular formula C30H37N7O8 and a molecular weight of 623.67 g/mol. Its IUPAC name is 4-[[carboxy(phenyl)methyl]amino]-3-[[2-[4-[3-(diaminomethylideneamino)propyl]-2,5-dioxo-3-(3-phenylpropyl)imidazolidin-1-yl]acetyl]amino]-4-oxobutanoic acid.
| Compound Name | 4-[[carboxy(phenyl)methyl]amino]-3-[[2-[4-[3-(diaminomethylideneamino)propyl]-2,5-dioxo-3-(3-phenylpropyl)imidazolidin-1-yl]acetyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 22945295 |
| Molecular Formula | C30H37N7O8 |
| Molecular Weight | 623.67 g/mol |
| Exact Mass | 623.27 |
| IUPAC Name | 4-[[carboxy(phenyl)methyl]amino]-3-[[2-[4-[3-(diaminomethylideneamino)propyl]-2,5-dioxo-3-(3-phenylpropyl)imidazolidin-1-yl]acetyl]amino]-4-oxobutanoic acid |
| SMILES | NC(N)=NCCCC1C(=O)N(CC(=O)NC(CC(=O)O)C(=O)NC(C(=O)O)c2ccccc2)C(=O)N1CCCc1ccccc1 |
| InChI | InChI=1S/C30H37N7O8/c31-29(32)33-15-7-14-22-27(42)37(30(45)36(22)16-8-11-19-9-3-1-4-10-19)18-23(38)34-21(17-24(39)40)26(41)35-25(28(43)44)20-12-5-2-6-13-20/h1-6,9-10,12-13,21-22,25H,7-8,11,14-18H2,(H,34,38)(H,35,41)(H,39,40)(H,43,44)(H4,31,32,33) |
| InChIKey | GVJRMFNKSGLNTD-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 237.82 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.67 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|