C10H18ClN5O4 — CID 67797400
2-[(4S)-4-[3-(diaminomethylideneamino)propyl]-3-methyl-2,5-dioxoimidazolidin-1-yl]acetic acid;hydrochloride (PubChem CID 67797400) has the molecular formula C10H18ClN5O4 and a molecular weight of 307.74 g/mol. Its IUPAC name is 2-[(4S)-4-[3-(diaminomethylideneamino)propyl]-3-methyl-2,5-dioxoimidazolidin-1-yl]acetic acid;hydrochloride.
| Compound Name | 2-[(4S)-4-[3-(diaminomethylideneamino)propyl]-3-methyl-2,5-dioxoimidazolidin-1-yl]acetic acid;hydrochloride |
|---|---|
| PubChem CID | 67797400 |
| Molecular Formula | C10H18ClN5O4 |
| Molecular Weight | 307.74 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | 2-[(4S)-4-[3-(diaminomethylideneamino)propyl]-3-methyl-2,5-dioxoimidazolidin-1-yl]acetic acid;hydrochloride |
| SMILES | CN1C(=O)N(CC(=O)O)C(=O)[C@@H]1CCCN=C(N)N.Cl |
| InChI | InChI=1S/C10H17N5O4.ClH/c1-14-6(3-2-4-13-9(11)12)8(18)15(10(14)19)5-7(16)17;/h6H,2-5H2,1H3,(H,16,17)(H4,11,12,13);1H/t6-;/m0./s1 |
| InChIKey | REMALCFAAVFCKO-RGMNGODLSA-N |
| XLogP | -1.19 |
| TPSA | 142.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.74 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|