C13H25N9O3 — CID 10066785
[N'-[[(2R,5S)-5-[3-(diaminomethylideneamino)propyl]-1-methyl-3,7-dioxo-1,4-diazepan-2-yl]methyl]carbamimidoyl]urea (PubChem CID 10066785) has the molecular formula C13H25N9O3 and a molecular weight of 355.40 g/mol. Its IUPAC name is [N'-[[(2R,5S)-5-[3-(diaminomethylideneamino)propyl]-1-methyl-3,7-dioxo-1,4-diazepan-2-yl]methyl]carbamimidoyl]urea.
| Compound Name | [N'-[[(2R,5S)-5-[3-(diaminomethylideneamino)propyl]-1-methyl-3,7-dioxo-1,4-diazepan-2-yl]methyl]carbamimidoyl]urea |
|---|---|
| PubChem CID | 10066785 |
| Molecular Formula | C13H25N9O3 |
| Molecular Weight | 355.40 g/mol |
| Exact Mass | 355.21 |
| IUPAC Name | [N'-[[(2R,5S)-5-[3-(diaminomethylideneamino)propyl]-1-methyl-3,7-dioxo-1,4-diazepan-2-yl]methyl]carbamimidoyl]urea |
| SMILES | CN1C(=O)C[C@H](CCCN=C(N)N)NC(=O)[C@H]1C/N=C(\N)NC(N)=O |
| InChI | InChI=1S/C13H25N9O3/c1-22-8(6-19-12(16)21-13(17)25)10(24)20-7(5-9(22)23)3-2-4-18-11(14)15/h7-8H,2-6H2,1H3,(H,20,24)(H4,14,15,18)(H5,16,17,19,21,25)/t7-,8+/m0/s1 |
| InChIKey | WXDPPHZLBSPZOA-JGVFFNPUSA-N |
| XLogP | -3.26 |
| TPSA | 207.31 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.40 |
| LogP ≤ 5 | -3.26 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|