C19H37N7O2 — CID 58488853
(2R,5S)-4-cyclopropyl-5-[3-(diaminomethylideneamino)propyl]-N-[6-(methylamino)hexyl]-6-oxopiperazine-2-carboxamide (PubChem CID 58488853) has the molecular formula C19H37N7O2 and a molecular weight of 395.55 g/mol. Its IUPAC name is (2R,5S)-4-cyclopropyl-5-[3-(diaminomethylideneamino)propyl]-N-[6-(methylamino)hexyl]-6-oxopiperazine-2-carboxamide.
| Compound Name | (2R,5S)-4-cyclopropyl-5-[3-(diaminomethylideneamino)propyl]-N-[6-(methylamino)hexyl]-6-oxopiperazine-2-carboxamide |
|---|---|
| PubChem CID | 58488853 |
| Molecular Formula | C19H37N7O2 |
| Molecular Weight | 395.55 g/mol |
| Exact Mass | 395.30 |
| IUPAC Name | (2R,5S)-4-cyclopropyl-5-[3-(diaminomethylideneamino)propyl]-N-[6-(methylamino)hexyl]-6-oxopiperazine-2-carboxamide |
| SMILES | CNCCCCCCNC(=O)[C@H]1CN(C2CC2)[C@@H](CCCN=C(N)N)C(=O)N1 |
| InChI | InChI=1S/C19H37N7O2/c1-22-10-4-2-3-5-11-23-17(27)15-13-26(14-8-9-14)16(18(28)25-15)7-6-12-24-19(20)21/h14-16,22H,2-13H2,1H3,(H,23,27)(H,25,28)(H4,20,21,24)/t15-,16+/m1/s1 |
| InChIKey | ZXROAHKKPYAKDE-CVEARBPZSA-N |
| XLogP | -0.73 |
| TPSA | 137.87 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.55 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|