C27H49N7O4 — CID 59008357
(2R,5R)-4-[(2R,5S)-5-butyl-6-oxopiperazine-2-carbonyl]-5-[3-(diaminomethylideneamino)propyl]-N-octyl-6-oxopiperidine-2-carboxamide (PubChem CID 59008357) has the molecular formula C27H49N7O4 and a molecular weight of 535.73 g/mol. Its IUPAC name is (2R,5R)-4-[(2R,5S)-5-butyl-6-oxopiperazine-2-carbonyl]-5-[3-(diaminomethylideneamino)propyl]-N-octyl-6-oxopiperidine-2-carboxamide.
| Compound Name | (2R,5R)-4-[(2R,5S)-5-butyl-6-oxopiperazine-2-carbonyl]-5-[3-(diaminomethylideneamino)propyl]-N-octyl-6-oxopiperidine-2-carboxamide |
|---|---|
| PubChem CID | 59008357 |
| Molecular Formula | C27H49N7O4 |
| Molecular Weight | 535.73 g/mol |
| Exact Mass | 535.38 |
| IUPAC Name | (2R,5R)-4-[(2R,5S)-5-butyl-6-oxopiperazine-2-carbonyl]-5-[3-(diaminomethylideneamino)propyl]-N-octyl-6-oxopiperidine-2-carboxamide |
| SMILES | CCCCCCCCNC(=O)[C@H]1CC(C(=O)[C@H]2CN[C@@H](CCCC)C(=O)N2)[C@@H](CCCN=C(N)N)C(=O)N1 |
| InChI | InChI=1S/C27H49N7O4/c1-3-5-7-8-9-10-14-30-25(37)21-16-19(18(24(36)33-21)12-11-15-31-27(28)29)23(35)22-17-32-20(13-6-4-2)26(38)34-22/h18-22,32H,3-17H2,1-2H3,(H,30,37)(H,33,36)(H,34,38)(H4,28,29,31)/t18-,19?,20+,21-,22-/m1/s1 |
| InChIKey | YWDSBJUMBPPVAD-JMSZQJPUSA-N |
| XLogP | 0.85 |
| TPSA | 180.80 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.73 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|