C27H43F3N8O7 — CID 73057207
N-[4-[(5S,8S,11S)-8-[3-(diaminomethylideneamino)propyl]-3,6,9,17-tetraoxo-11-(2,2,2-trifluoroacetyl)-1-oxa-4,7,10,16-tetrazacyclooctadec-5-yl]butyl]cyclopropanecarboxamide (PubChem CID 73057207) has the molecular formula C27H43F3N8O7 and a molecular weight of 648.68 g/mol. Its IUPAC name is N-[4-[(5S,8S,11S)-8-[3-(diaminomethylideneamino)propyl]-3,6,9,17-tetraoxo-11-(2,2,2-trifluoroacetyl)-1-oxa-4,7,10,16-tetrazacyclooctadec-5-yl]butyl]cyclopropanecarboxamide.
| Compound Name | N-[4-[(5S,8S,11S)-8-[3-(diaminomethylideneamino)propyl]-3,6,9,17-tetraoxo-11-(2,2,2-trifluoroacetyl)-1-oxa-4,7,10,16-tetrazacyclooctadec-5-yl]butyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 73057207 |
| Molecular Formula | C27H43F3N8O7 |
| Molecular Weight | 648.68 g/mol |
| Exact Mass | 648.32 |
| IUPAC Name | N-[4-[(5S,8S,11S)-8-[3-(diaminomethylideneamino)propyl]-3,6,9,17-tetraoxo-11-(2,2,2-trifluoroacetyl)-1-oxa-4,7,10,16-tetrazacyclooctadec-5-yl]butyl]cyclopropanecarboxamide |
| SMILES | NC(N)=NCCC[C@@H]1NC(=O)[C@H](CCCCNC(=O)C2CC2)NC(=O)COCC(=O)NCCCC[C@@H](C(=O)C(F)(F)F)NC1=O |
| InChI | InChI=1S/C27H43F3N8O7/c28-27(29,30)22(41)17-6-1-3-11-33-20(39)14-45-15-21(40)36-18(7-2-4-12-34-23(42)16-9-10-16)24(43)38-19(25(44)37-17)8-5-13-35-26(31)32/h16-19H,1-15H2,(H,33,39)(H,34,42)(H,36,40)(H,37,44)(H,38,43)(H4,31,32,35)/t17-,18-,19-/m0/s1 |
| InChIKey | HWDDIDSLGNGZFX-FHWLQOOXSA-N |
| XLogP | -1.36 |
| TPSA | 236.20 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.68 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|