C23H42N4O6 — CID 146116284
3,3-dimethyl-N-[4-(6,9,12-trioxo-11-propyl-1,4-dioxa-7,10,13-triazacyclopentadec-8-yl)butyl]butanamide (PubChem CID 146116284) has the molecular formula C23H42N4O6 and a molecular weight of 470.61 g/mol. Its IUPAC name is 3,3-dimethyl-N-[4-(6,9,12-trioxo-11-propyl-1,4-dioxa-7,10,13-triazacyclopentadec-8-yl)butyl]butanamide.
| Compound Name | 3,3-dimethyl-N-[4-(6,9,12-trioxo-11-propyl-1,4-dioxa-7,10,13-triazacyclopentadec-8-yl)butyl]butanamide |
|---|---|
| PubChem CID | 146116284 |
| Molecular Formula | C23H42N4O6 |
| Molecular Weight | 470.61 g/mol |
| Exact Mass | 470.31 |
| IUPAC Name | 3,3-dimethyl-N-[4-(6,9,12-trioxo-11-propyl-1,4-dioxa-7,10,13-triazacyclopentadec-8-yl)butyl]butanamide |
| SMILES | CCCC1NC(=O)C(CCCCNC(=O)CC(C)(C)C)NC(=O)COCCOCCNC1=O |
| InChI | InChI=1S/C23H42N4O6/c1-5-8-17-21(30)25-11-12-32-13-14-33-16-20(29)26-18(22(31)27-17)9-6-7-10-24-19(28)15-23(2,3)4/h17-18H,5-16H2,1-4H3,(H,24,28)(H,25,30)(H,26,29)(H,27,31) |
| InChIKey | GSVMLAISUZCPDZ-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 134.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.61 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|