C22H38N6O7 — CID 145201831
tert-butyl N-[4-[(3S,9S)-9-methyl-2,5,8,11,14-pentaoxo-1,4,7,10,13-pentazacycloheptadec-3-yl]butyl]carbamate (PubChem CID 145201831) has the molecular formula C22H38N6O7 and a molecular weight of 498.58 g/mol. Its IUPAC name is tert-butyl N-[4-[(3S,9S)-9-methyl-2,5,8,11,14-pentaoxo-1,4,7,10,13-pentazacycloheptadec-3-yl]butyl]carbamate.
| Compound Name | tert-butyl N-[4-[(3S,9S)-9-methyl-2,5,8,11,14-pentaoxo-1,4,7,10,13-pentazacycloheptadec-3-yl]butyl]carbamate |
|---|---|
| PubChem CID | 145201831 |
| Molecular Formula | C22H38N6O7 |
| Molecular Weight | 498.58 g/mol |
| Exact Mass | 498.28 |
| IUPAC Name | tert-butyl N-[4-[(3S,9S)-9-methyl-2,5,8,11,14-pentaoxo-1,4,7,10,13-pentazacycloheptadec-3-yl]butyl]carbamate |
| SMILES | C[C@@H]1NC(=O)CNC(=O)CCCNC(=O)[C@H](CCCCNC(=O)OC(C)(C)C)NC(=O)CNC1=O |
| InChI | InChI=1S/C22H38N6O7/c1-14-19(32)26-13-18(31)28-15(8-5-6-10-24-21(34)35-22(2,3)4)20(33)23-11-7-9-16(29)25-12-17(30)27-14/h14-15H,5-13H2,1-4H3,(H,23,33)(H,24,34)(H,25,29)(H,26,32)(H,27,30)(H,28,31)/t14-,15-/m0/s1 |
| InChIKey | CHLFBEDHYWJDIW-GJZGRUSLSA-N |
| XLogP | -1.19 |
| TPSA | 183.83 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.58 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|