C14H28N2O3 — CID 176665923
tert-butyl N-[4-[(2S,6R)-6-methylmorpholin-2-yl]butyl]carbamate (PubChem CID 176665923) has the molecular formula C14H28N2O3 and a molecular weight of 272.39 g/mol. Its IUPAC name is tert-butyl N-[4-[(2S,6R)-6-methylmorpholin-2-yl]butyl]carbamate.
| Compound Name | tert-butyl N-[4-[(2S,6R)-6-methylmorpholin-2-yl]butyl]carbamate |
|---|---|
| PubChem CID | 176665923 |
| Molecular Formula | C14H28N2O3 |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.21 |
| IUPAC Name | tert-butyl N-[4-[(2S,6R)-6-methylmorpholin-2-yl]butyl]carbamate |
| SMILES | C[C@@H]1CNC[C@H](CCCCNC(=O)OC(C)(C)C)O1 |
| InChI | InChI=1S/C14H28N2O3/c1-11-9-15-10-12(18-11)7-5-6-8-16-13(17)19-14(2,3)4/h11-12,15H,5-10H2,1-4H3,(H,16,17)/t11-,12+/m1/s1 |
| InChIKey | YUPXFBNNQYOKKM-NEPJUHHUSA-N |
| XLogP | 2.06 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|