C14H26N2O4 — CID 129239435
tert-butyl N-[4-(6-methyl-2-oxomorpholin-3-yl)butyl]carbamate (PubChem CID 129239435) has the molecular formula C14H26N2O4 and a molecular weight of 286.37 g/mol. Its IUPAC name is tert-butyl N-[4-(6-methyl-2-oxomorpholin-3-yl)butyl]carbamate.
| Compound Name | tert-butyl N-[4-(6-methyl-2-oxomorpholin-3-yl)butyl]carbamate |
|---|---|
| PubChem CID | 129239435 |
| Molecular Formula | C14H26N2O4 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.19 |
| IUPAC Name | tert-butyl N-[4-(6-methyl-2-oxomorpholin-3-yl)butyl]carbamate |
| SMILES | CC1CNC(CCCCNC(=O)OC(C)(C)C)C(=O)O1 |
| InChI | InChI=1S/C14H26N2O4/c1-10-9-16-11(12(17)19-10)7-5-6-8-15-13(18)20-14(2,3)4/h10-11,16H,5-9H2,1-4H3,(H,15,18) |
| InChIKey | HRUDFIYJBLTLSG-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|