C19H36N2O6 — CID 154673173
tert-butyl 3-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]-2-oxomorpholine-4-carboxylate;ethane (PubChem CID 154673173) has the molecular formula C19H36N2O6 and a molecular weight of 388.51 g/mol. Its IUPAC name is tert-butyl 3-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]-2-oxomorpholine-4-carboxylate;ethane.
| Compound Name | tert-butyl 3-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]-2-oxomorpholine-4-carboxylate;ethane |
|---|---|
| PubChem CID | 154673173 |
| Molecular Formula | C19H36N2O6 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.26 |
| IUPAC Name | tert-butyl 3-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]-2-oxomorpholine-4-carboxylate;ethane |
| SMILES | CC.CC(C)(C)OC(=O)NCCCC1C(=O)OCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H30N2O6.C2H6/c1-16(2,3)24-14(21)18-9-7-8-12-13(20)23-11-10-19(12)15(22)25-17(4,5)6;1-2/h12H,7-11H2,1-6H3,(H,18,21);1-2H3 |
| InChIKey | NVTOFCVQDVDRRK-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|