C17H24BrNO3 — CID 157284369
tert-butyl N-[3-(7-bromo-3,4-dihydro-2H-chromen-4-yl)propyl]carbamate (PubChem CID 157284369) has the molecular formula C17H24BrNO3 and a molecular weight of 370.29 g/mol. Its IUPAC name is tert-butyl N-[3-(7-bromo-3,4-dihydro-2H-chromen-4-yl)propyl]carbamate.
| Compound Name | tert-butyl N-[3-(7-bromo-3,4-dihydro-2H-chromen-4-yl)propyl]carbamate |
|---|---|
| PubChem CID | 157284369 |
| Molecular Formula | C17H24BrNO3 |
| Molecular Weight | 370.29 g/mol |
| Exact Mass | 369.09 |
| IUPAC Name | tert-butyl N-[3-(7-bromo-3,4-dihydro-2H-chromen-4-yl)propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCC1CCOc2cc(Br)ccc21 |
| InChI | InChI=1S/C17H24BrNO3/c1-17(2,3)22-16(20)19-9-4-5-12-8-10-21-15-11-13(18)6-7-14(12)15/h6-7,11-12H,4-5,8-10H2,1-3H3,(H,19,20) |
| InChIKey | HUAJVVIIWPGQMQ-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.29 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|