C27H40F2N2O3 — CID 142904437
tert-butyl N-[3-[(6-methyl-3,4-dihydro-2H-chromen-4-yl)amino]propyl]carbamate;1,3-difluoro-5-methylbenzene;ethane (PubChem CID 142904437) has the molecular formula C27H40F2N2O3 and a molecular weight of 478.62 g/mol. Its IUPAC name is tert-butyl N-[3-[(6-methyl-3,4-dihydro-2H-chromen-4-yl)amino]propyl]carbamate;1,3-difluoro-5-methylbenzene;ethane.
| Compound Name | tert-butyl N-[3-[(6-methyl-3,4-dihydro-2H-chromen-4-yl)amino]propyl]carbamate;1,3-difluoro-5-methylbenzene;ethane |
|---|---|
| PubChem CID | 142904437 |
| Molecular Formula | C27H40F2N2O3 |
| Molecular Weight | 478.62 g/mol |
| Exact Mass | 478.30 |
| IUPAC Name | tert-butyl N-[3-[(6-methyl-3,4-dihydro-2H-chromen-4-yl)amino]propyl]carbamate;1,3-difluoro-5-methylbenzene;ethane |
| SMILES | CC.Cc1cc(F)cc(F)c1.Cc1ccc2c(c1)C(NCCCNC(=O)OC(C)(C)C)CCO2 |
| InChI | InChI=1S/C18H28N2O3.C7H6F2.C2H6/c1-13-6-7-16-14(12-13)15(8-11-22-16)19-9-5-10-20-17(21)23-18(2,3)4;1-5-2-6(8)4-7(9)3-5;1-2/h6-7,12,15,19H,5,8-11H2,1-4H3,(H,20,21);2-4H,1H3;1-2H3 |
| InChIKey | GJMPTFBKHUQFDA-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.62 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|