C14H19NO4 — CID 164592811
tert-butyl N-[(4R)-6-hydroxy-3,4-dihydro-2H-chromen-4-yl]carbamate (PubChem CID 164592811) has the molecular formula C14H19NO4 and a molecular weight of 265.31 g/mol. Its IUPAC name is tert-butyl N-[(4R)-6-hydroxy-3,4-dihydro-2H-chromen-4-yl]carbamate.
| Compound Name | tert-butyl N-[(4R)-6-hydroxy-3,4-dihydro-2H-chromen-4-yl]carbamate |
|---|---|
| PubChem CID | 164592811 |
| Molecular Formula | C14H19NO4 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | tert-butyl N-[(4R)-6-hydroxy-3,4-dihydro-2H-chromen-4-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CCOc2ccc(O)cc21 |
| InChI | InChI=1S/C14H19NO4/c1-14(2,3)19-13(17)15-11-6-7-18-12-5-4-9(16)8-10(11)12/h4-5,8,11,16H,6-7H2,1-3H3,(H,15,17)/t11-/m1/s1 |
| InChIKey | FIWIUPVUDGYINI-LLVKDONJSA-N |
| XLogP | 2.74 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |