C11H15NO2 — CID 105447097
4-(ethylamino)-3,4-dihydro-2H-chromen-6-ol (PubChem CID 105447097) has the molecular formula C11H15NO2 and a molecular weight of 193.25 g/mol. Its IUPAC name is 4-(ethylamino)-3,4-dihydro-2H-chromen-6-ol.
| Compound Name | 4-(ethylamino)-3,4-dihydro-2H-chromen-6-ol |
|---|---|
| PubChem CID | 105447097 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | 4-(ethylamino)-3,4-dihydro-2H-chromen-6-ol |
| SMILES | CCNC1CCOc2ccc(O)cc21 |
| InChI | InChI=1S/C11H15NO2/c1-2-12-10-5-6-14-11-4-3-8(13)7-9(10)11/h3-4,7,10,12-13H,2,5-6H2,1H3 |
| InChIKey | TYLXGNVIAOQAFW-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |