C12H17NO2 — CID 105460519
4-[(dimethylamino)methyl]-3,4-dihydro-2H-chromen-6-ol (PubChem CID 105460519) has the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. Its IUPAC name is 4-[(dimethylamino)methyl]-3,4-dihydro-2H-chromen-6-ol.
| Compound Name | 4-[(dimethylamino)methyl]-3,4-dihydro-2H-chromen-6-ol |
|---|---|
| PubChem CID | 105460519 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | 4-[(dimethylamino)methyl]-3,4-dihydro-2H-chromen-6-ol |
| SMILES | CN(C)CC1CCOc2ccc(O)cc21 |
| InChI | InChI=1S/C12H17NO2/c1-13(2)8-9-5-6-15-12-4-3-10(14)7-11(9)12/h3-4,7,9,14H,5-6,8H2,1-2H3 |
| InChIKey | CVHZYLXXQWGQRQ-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |