C10H12O3 — CID 105438603
4-(hydroxymethyl)-3,4-dihydro-2H-chromen-7-ol (PubChem CID 105438603) has the molecular formula C10H12O3 and a molecular weight of 180.20 g/mol. Its IUPAC name is 4-(hydroxymethyl)-3,4-dihydro-2H-chromen-7-ol.
| Compound Name | 4-(hydroxymethyl)-3,4-dihydro-2H-chromen-7-ol |
|---|---|
| PubChem CID | 105438603 |
| Molecular Formula | C10H12O3 |
| Molecular Weight | 180.20 g/mol |
| Exact Mass | 180.08 |
| IUPAC Name | 4-(hydroxymethyl)-3,4-dihydro-2H-chromen-7-ol |
| SMILES | OCC1CCOc2cc(O)ccc21 |
| InChI | InChI=1S/C10H12O3/c11-6-7-3-4-13-10-5-8(12)1-2-9(7)10/h1-2,5,7,11-12H,3-4,6H2 |
| InChIKey | UPEGERYFQUZVQD-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.20 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |