C10H12N2O3 — CID 117246887
4-amino-9-hydroxy-2,3,4,6-tetrahydro-1,6-benzoxazocin-5-one (PubChem CID 117246887) has the molecular formula C10H12N2O3 and a molecular weight of 208.22 g/mol. Its IUPAC name is 4-amino-9-hydroxy-2,3,4,6-tetrahydro-1,6-benzoxazocin-5-one.
| Compound Name | 4-amino-9-hydroxy-2,3,4,6-tetrahydro-1,6-benzoxazocin-5-one |
|---|---|
| PubChem CID | 117246887 |
| Molecular Formula | C10H12N2O3 |
| Molecular Weight | 208.22 g/mol |
| Exact Mass | 208.08 |
| IUPAC Name | 4-amino-9-hydroxy-2,3,4,6-tetrahydro-1,6-benzoxazocin-5-one |
| SMILES | NC1CCOc2cc(O)ccc2NC1=O |
| InChI | InChI=1S/C10H12N2O3/c11-7-3-4-15-9-5-6(13)1-2-8(9)12-10(7)14/h1-2,5,7,13H,3-4,11H2,(H,12,14) |
| InChIKey | GTZYAUUICYELOL-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.22 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|