C10H10N2O2 — CID 84719468
2'-amino-5-hydroxyspiro[1H-indole-3,1'-cyclopropane]-2-one (PubChem CID 84719468) has the molecular formula C10H10N2O2 and a molecular weight of 190.20 g/mol. Its IUPAC name is 2'-amino-5-hydroxyspiro[1H-indole-3,1'-cyclopropane]-2-one.
| Compound Name | 2'-amino-5-hydroxyspiro[1H-indole-3,1'-cyclopropane]-2-one |
|---|---|
| PubChem CID | 84719468 |
| Molecular Formula | C10H10N2O2 |
| Molecular Weight | 190.20 g/mol |
| Exact Mass | 190.07 |
| IUPAC Name | 2'-amino-5-hydroxyspiro[1H-indole-3,1'-cyclopropane]-2-one |
| SMILES | NC1CC12C(=O)Nc1ccc(O)cc12 |
| InChI | InChI=1S/C10H10N2O2/c11-8-4-10(8)6-3-5(13)1-2-7(6)12-9(10)14/h1-3,8,13H,4,11H2,(H,12,14) |
| InChIKey | XDERBXMIZHVFBH-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.20 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|