C9H10N2O2 — CID 86339030
(3R)-3-amino-7-hydroxy-3,4-dihydro-1H-quinolin-2-one (PubChem CID 86339030) has the molecular formula C9H10N2O2 and a molecular weight of 178.19 g/mol. Its IUPAC name is (3R)-3-amino-7-hydroxy-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | (3R)-3-amino-7-hydroxy-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 86339030 |
| Molecular Formula | C9H10N2O2 |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.07 |
| IUPAC Name | (3R)-3-amino-7-hydroxy-3,4-dihydro-1H-quinolin-2-one |
| SMILES | N[C@@H]1Cc2ccc(O)cc2NC1=O |
| InChI | InChI=1S/C9H10N2O2/c10-7-3-5-1-2-6(12)4-8(5)11-9(7)13/h1-2,4,7,12H,3,10H2,(H,11,13)/t7-/m1/s1 |
| InChIKey | MVKKHTOWVDIYTH-SSDOTTSWSA-N |
| XLogP | 0.21 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |