C11H12N2O2 — CID 84721821
2'-amino-6-methoxyspiro[1H-indole-3,1'-cyclopropane]-2-one (PubChem CID 84721821) has the molecular formula C11H12N2O2 and a molecular weight of 204.23 g/mol. Its IUPAC name is 2'-amino-6-methoxyspiro[1H-indole-3,1'-cyclopropane]-2-one.
| Compound Name | 2'-amino-6-methoxyspiro[1H-indole-3,1'-cyclopropane]-2-one |
|---|---|
| PubChem CID | 84721821 |
| Molecular Formula | C11H12N2O2 |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.09 |
| IUPAC Name | 2'-amino-6-methoxyspiro[1H-indole-3,1'-cyclopropane]-2-one |
| SMILES | COc1ccc2c(c1)NC(=O)C21CC1N |
| InChI | InChI=1S/C11H12N2O2/c1-15-6-2-3-7-8(4-6)13-10(14)11(7)5-9(11)12/h2-4,9H,5,12H2,1H3,(H,13,14) |
| InChIKey | KLIYWUSPKNFXFZ-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |