C26H25N3O2 — CID 53495887
(2'S,3S,5'S)-1'-benzyl-5'-ethenyl-6-methoxy-2'-pyridin-3-ylspiro[1H-indole-3,3'-pyrrolidine]-2-one (PubChem CID 53495887) has the molecular formula C26H25N3O2 and a molecular weight of 411.51 g/mol. Its IUPAC name is (2'S,3S,5'S)-1'-benzyl-5'-ethenyl-6-methoxy-2'-pyridin-3-ylspiro[1H-indole-3,3'-pyrrolidine]-2-one.
| Compound Name | (2'S,3S,5'S)-1'-benzyl-5'-ethenyl-6-methoxy-2'-pyridin-3-ylspiro[1H-indole-3,3'-pyrrolidine]-2-one |
|---|---|
| PubChem CID | 53495887 |
| Molecular Formula | C26H25N3O2 |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.19 |
| IUPAC Name | (2'S,3S,5'S)-1'-benzyl-5'-ethenyl-6-methoxy-2'-pyridin-3-ylspiro[1H-indole-3,3'-pyrrolidine]-2-one |
| SMILES | C=C[C@@H]1C[C@@]2(C(=O)Nc3cc(OC)ccc32)[C@H](c2cccnc2)N1Cc1ccccc1 |
| InChI | InChI=1S/C26H25N3O2/c1-3-20-15-26(22-12-11-21(31-2)14-23(22)28-25(26)30)24(19-10-7-13-27-16-19)29(20)17-18-8-5-4-6-9-18/h3-14,16,20,24H,1,15,17H2,2H3,(H,28,30)/t20-,24+,26+/m1/s1 |
| InChIKey | IFVCHHASQAZRPM-PSUQPPDWSA-N |
| XLogP | 4.48 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|