C21H23N3O4 — CID 139235618
(5S,6S)-6'-methoxy-6-[(Z)-prop-1-enyl]spiro[1,7-diazatricyclo[7.3.0.03,7]dodecane-5,3'-1H-indole]-2,2',8-trione (PubChem CID 139235618) has the molecular formula C21H23N3O4 and a molecular weight of 381.43 g/mol. Its IUPAC name is (5S,6S)-6'-methoxy-6-[(Z)-prop-1-enyl]spiro[1,7-diazatricyclo[7.3.0.03,7]dodecane-5,3'-1H-indole]-2,2',8-trione.
| Compound Name | (5S,6S)-6'-methoxy-6-[(Z)-prop-1-enyl]spiro[1,7-diazatricyclo[7.3.0.03,7]dodecane-5,3'-1H-indole]-2,2',8-trione |
|---|---|
| PubChem CID | 139235618 |
| Molecular Formula | C21H23N3O4 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | (5S,6S)-6'-methoxy-6-[(Z)-prop-1-enyl]spiro[1,7-diazatricyclo[7.3.0.03,7]dodecane-5,3'-1H-indole]-2,2',8-trione |
| SMILES | C/C=C\[C@@H]1N2C(=O)C3CCCN3C(=O)C2C[C@@]12C(=O)Nc1cc(OC)ccc12 |
| InChI | InChI=1S/C21H23N3O4/c1-3-5-17-21(13-8-7-12(28-2)10-14(13)22-20(21)27)11-16-18(25)23-9-4-6-15(23)19(26)24(16)17/h3,5,7-8,10,15-17H,4,6,9,11H2,1-2H3,(H,22,27)/b5-3-/t15?,16?,17-,21-/m0/s1 |
| InChIKey | QDPHPUDLTHVVHV-YKSHYAJWSA-N |
| XLogP | 1.44 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|