C28H39N3O6 — CID 134948193
tert-butyl N-[2-[(3S,5S,6S,9S)-5-ethenyl-6-(2-hydroxy-2-methylpropyl)-2,8-dioxo-1,7-diazatricyclo[7.3.0.03,7]dodecan-5-yl]-5-methoxyphenyl]carbamate (PubChem CID 134948193) has the molecular formula C28H39N3O6 and a molecular weight of 513.64 g/mol. Its IUPAC name is tert-butyl N-[2-[(3S,5S,6S,9S)-5-ethenyl-6-(2-hydroxy-2-methylpropyl)-2,8-dioxo-1,7-diazatricyclo[7.3.0.03,7]dodecan-5-yl]-5-methoxyphenyl]carbamate.
| Compound Name | tert-butyl N-[2-[(3S,5S,6S,9S)-5-ethenyl-6-(2-hydroxy-2-methylpropyl)-2,8-dioxo-1,7-diazatricyclo[7.3.0.03,7]dodecan-5-yl]-5-methoxyphenyl]carbamate |
|---|---|
| PubChem CID | 134948193 |
| Molecular Formula | C28H39N3O6 |
| Molecular Weight | 513.64 g/mol |
| Exact Mass | 513.28 |
| IUPAC Name | tert-butyl N-[2-[(3S,5S,6S,9S)-5-ethenyl-6-(2-hydroxy-2-methylpropyl)-2,8-dioxo-1,7-diazatricyclo[7.3.0.03,7]dodecan-5-yl]-5-methoxyphenyl]carbamate |
| SMILES | C=C[C@]1(c2ccc(OC)cc2NC(=O)OC(C)(C)C)C[C@H]2C(=O)N3CCC[C@H]3C(=O)N2[C@H]1CC(C)(C)O |
| InChI | InChI=1S/C28H39N3O6/c1-8-28(18-12-11-17(36-7)14-19(18)29-25(34)37-26(2,3)4)15-21-23(32)30-13-9-10-20(30)24(33)31(21)22(28)16-27(5,6)35/h8,11-12,14,20-22,35H,1,9-10,13,15-16H2,2-7H3,(H,29,34)/t20-,21-,22-,28+/m0/s1 |
| InChIKey | YKJNXBGNSFPQCW-MIUQQGMZSA-N |
| XLogP | 3.60 |
| TPSA | 108.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.64 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|