C28H34N2O3 — CID 59918100
(1S,12S,15S)-7-methoxy-10-(3-methylbut-2-enyl)-12-(2-methylprop-1-enyl)-13,19-diazapentacyclo[11.7.0.03,11.04,9.015,19]icosa-3(11),4(9),5,7-tetraene-14,20-dione (PubChem CID 59918100) has the molecular formula C28H34N2O3 and a molecular weight of 446.59 g/mol. Its IUPAC name is (1S,12S,15S)-7-methoxy-10-(3-methylbut-2-enyl)-12-(2-methylprop-1-enyl)-13,19-diazapentacyclo[11.7.0.03,11.04,9.015,19]icosa-3(11),4(9),5,7-tetraene-14,20-dione.
| Compound Name | (1S,12S,15S)-7-methoxy-10-(3-methylbut-2-enyl)-12-(2-methylprop-1-enyl)-13,19-diazapentacyclo[11.7.0.03,11.04,9.015,19]icosa-3(11),4(9),5,7-tetraene-14,20-dione |
|---|---|
| PubChem CID | 59918100 |
| Molecular Formula | C28H34N2O3 |
| Molecular Weight | 446.59 g/mol |
| Exact Mass | 446.26 |
| IUPAC Name | (1S,12S,15S)-7-methoxy-10-(3-methylbut-2-enyl)-12-(2-methylprop-1-enyl)-13,19-diazapentacyclo[11.7.0.03,11.04,9.015,19]icosa-3(11),4(9),5,7-tetraene-14,20-dione |
| SMILES | COc1ccc2c(c1)C(CC=C(C)C)C1=C2C[C@H]2C(=O)N3CCC[C@H]3C(=O)N2[C@H]1C=C(C)C |
| InChI | InChI=1S/C28H34N2O3/c1-16(2)8-10-20-21-14-18(33-5)9-11-19(21)22-15-25-27(31)29-12-6-7-23(29)28(32)30(25)24(26(20)22)13-17(3)4/h8-9,11,13-14,20,23-25H,6-7,10,12,15H2,1-5H3/t20?,23-,24-,25-/m0/s1 |
| InChIKey | BGUPBPGFBKMXBC-FQNOENOBSA-N |
| XLogP | 4.84 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.59 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|