C23H25N3O4 — CID 46885578
(5S,6S,9S)-6'-methoxy-1'-methyl-6-(2-methylprop-1-enyl)spiro[1,7-diazatricyclo[7.3.0.03,7]dodec-3-ene-5,3'-indole]-2,2',8-trione (PubChem CID 46885578) has the molecular formula C23H25N3O4 and a molecular weight of 407.47 g/mol. Its IUPAC name is (5S,6S,9S)-6'-methoxy-1'-methyl-6-(2-methylprop-1-enyl)spiro[1,7-diazatricyclo[7.3.0.03,7]dodec-3-ene-5,3'-indole]-2,2',8-trione.
| Compound Name | (5S,6S,9S)-6'-methoxy-1'-methyl-6-(2-methylprop-1-enyl)spiro[1,7-diazatricyclo[7.3.0.03,7]dodec-3-ene-5,3'-indole]-2,2',8-trione |
|---|---|
| PubChem CID | 46885578 |
| Molecular Formula | C23H25N3O4 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | (5S,6S,9S)-6'-methoxy-1'-methyl-6-(2-methylprop-1-enyl)spiro[1,7-diazatricyclo[7.3.0.03,7]dodec-3-ene-5,3'-indole]-2,2',8-trione |
| SMILES | COc1ccc2c(c1)N(C)C(=O)[C@@]21C=C2C(=O)N3CCC[C@H]3C(=O)N2[C@H]1C=C(C)C |
| InChI | InChI=1S/C23H25N3O4/c1-13(2)10-19-23(15-8-7-14(30-4)11-17(15)24(3)22(23)29)12-18-20(27)25-9-5-6-16(25)21(28)26(18)19/h7-8,10-12,16,19H,5-6,9H2,1-4H3/t16-,19-,23-/m0/s1 |
| InChIKey | BJEHAZOMBPUZRW-NVVBAYIOSA-N |
| XLogP | 1.97 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|