C21H24N2O4 — CID 71686152
(3R,7aS)-3-(2,5-dimethoxyphenyl)-2-(4-methoxyphenyl)-5,6,7,7a-tetrahydro-3H-pyrrolo[1,2-c]imidazol-1-one (PubChem CID 71686152) has the molecular formula C21H24N2O4 and a molecular weight of 368.43 g/mol. Its IUPAC name is (3R,7aS)-3-(2,5-dimethoxyphenyl)-2-(4-methoxyphenyl)-5,6,7,7a-tetrahydro-3H-pyrrolo[1,2-c]imidazol-1-one.
| Compound Name | (3R,7aS)-3-(2,5-dimethoxyphenyl)-2-(4-methoxyphenyl)-5,6,7,7a-tetrahydro-3H-pyrrolo[1,2-c]imidazol-1-one |
|---|---|
| PubChem CID | 71686152 |
| Molecular Formula | C21H24N2O4 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | (3R,7aS)-3-(2,5-dimethoxyphenyl)-2-(4-methoxyphenyl)-5,6,7,7a-tetrahydro-3H-pyrrolo[1,2-c]imidazol-1-one |
| SMILES | COc1ccc(N2C(=O)[C@@H]3CCCN3[C@H]2c2cc(OC)ccc2OC)cc1 |
| InChI | InChI=1S/C21H24N2O4/c1-25-15-8-6-14(7-9-15)23-20(22-12-4-5-18(22)21(23)24)17-13-16(26-2)10-11-19(17)27-3/h6-11,13,18,20H,4-5,12H2,1-3H3/t18-,20+/m0/s1 |
| InChIKey | BMGPWUBXRHZYJV-AZUAARDMSA-N |
| XLogP | 3.22 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |