C19H18BrClN2O2 — CID 71686253
(3R,7aS)-3-(3-bromophenyl)-2-(3-chloro-4-methoxyphenyl)-5,6,7,7a-tetrahydro-3H-pyrrolo[1,2-c]imidazol-1-one (PubChem CID 71686253) has the molecular formula C19H18BrClN2O2 and a molecular weight of 421.72 g/mol. Its IUPAC name is (3R,7aS)-3-(3-bromophenyl)-2-(3-chloro-4-methoxyphenyl)-5,6,7,7a-tetrahydro-3H-pyrrolo[1,2-c]imidazol-1-one.
| Compound Name | (3R,7aS)-3-(3-bromophenyl)-2-(3-chloro-4-methoxyphenyl)-5,6,7,7a-tetrahydro-3H-pyrrolo[1,2-c]imidazol-1-one |
|---|---|
| PubChem CID | 71686253 |
| Molecular Formula | C19H18BrClN2O2 |
| Molecular Weight | 421.72 g/mol |
| Exact Mass | 420.02 |
| IUPAC Name | (3R,7aS)-3-(3-bromophenyl)-2-(3-chloro-4-methoxyphenyl)-5,6,7,7a-tetrahydro-3H-pyrrolo[1,2-c]imidazol-1-one |
| SMILES | COc1ccc(N2C(=O)[C@@H]3CCCN3[C@H]2c2cccc(Br)c2)cc1Cl |
| InChI | InChI=1S/C19H18BrClN2O2/c1-25-17-8-7-14(11-15(17)21)23-18(12-4-2-5-13(20)10-12)22-9-3-6-16(22)19(23)24/h2,4-5,7-8,10-11,16,18H,3,6,9H2,1H3/t16-,18+/m0/s1 |
| InChIKey | YOVOWDVHPIBNCW-FUHWJXTLSA-N |
| XLogP | 4.62 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.72 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |